C17H23ClN2O4S2 — CID 133187089
6-chloro-N-(2-cyclopentylsulfanylethyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 133187089) has the molecular formula C17H23ClN2O4S2 and a molecular weight of 418.97 g/mol. Its IUPAC name is 6-chloro-N-(2-cyclopentylsulfanylethyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 6-chloro-N-(2-cyclopentylsulfanylethyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 133187089 |
| Molecular Formula | C17H23ClN2O4S2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 6-chloro-N-(2-cyclopentylsulfanylethyl)-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CS(=O)(=O)N1CC(C(=O)NCCSC2CCCC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H23ClN2O4S2/c1-26(22,23)20-11-16(24-15-7-6-12(18)10-14(15)20)17(21)19-8-9-25-13-4-2-3-5-13/h6-7,10,13,16H,2-5,8-9,11H2,1H3,(H,19,21) |
| InChIKey | WZRMLISOHVTLDA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|