C23H23ClN2O3S — CID 28633983
2-(3-chloro-N-methylsulfonylanilino)-N-[(S)-(4-methylphenyl)-phenylmethyl]acetamide (PubChem CID 28633983) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is 2-(3-chloro-N-methylsulfonylanilino)-N-[(S)-(4-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[(S)-(4-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 28633983 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[(S)-(4-methylphenyl)-phenylmethyl]acetamide |
| SMILES | Cc1ccc([C@@H](NC(=O)CN(c2cccc(Cl)c2)S(C)(=O)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23ClN2O3S/c1-17-11-13-19(14-12-17)23(18-7-4-3-5-8-18)25-22(27)16-26(30(2,28)29)21-10-6-9-20(24)15-21/h3-15,23H,16H2,1-2H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | HDOGKHMTNIRDMB-QHCPKHFHSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |