C28H25ClN2O4S — CID 2225967
2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(S)-(4-methoxyphenyl)-phenylmethyl]acetamide (PubChem CID 2225967) has the molecular formula C28H25ClN2O4S and a molecular weight of 521.04 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(S)-(4-methoxyphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(S)-(4-methoxyphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 2225967 |
| Molecular Formula | C28H25ClN2O4S |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(S)-(4-methoxyphenyl)-phenylmethyl]acetamide |
| SMILES | COc1ccc([C@@H](NC(=O)CN(c2cccc(Cl)c2)S(=O)(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25ClN2O4S/c1-35-25-17-15-22(16-18-25)28(21-9-4-2-5-10-21)30-27(32)20-31(24-12-8-11-23(29)19-24)36(33,34)26-13-6-3-7-14-26/h2-19,28H,20H2,1H3,(H,30,32)/t28-/m0/s1 |
| InChIKey | ZWWZCOFJLOTJRB-NDEPHWFRSA-N |
| XLogP | 5.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |