C29H28N2O4S — CID 43885385
2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[(4-methylphenyl)-phenylmethyl]acetamide (PubChem CID 43885385) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[(4-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[(4-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 43885385 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-methoxyanilino]-N-[(4-methylphenyl)-phenylmethyl]acetamide |
| SMILES | COc1cccc(N(CC(=O)NC(c2ccccc2)c2ccc(C)cc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H28N2O4S/c1-22-16-18-24(19-17-22)29(23-10-5-3-6-11-23)30-28(32)21-31(25-12-9-13-26(20-25)35-2)36(33,34)27-14-7-4-8-15-27/h3-20,29H,21H2,1-2H3,(H,30,32) |
| InChIKey | UMVSNLCYADRDRG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |