C23H25N3O4S — CID 28637844
methyl 3-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioylcarbamoyl]benzoate (PubChem CID 28637844) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is methyl 3-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 28637844 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | methyl 3-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(=S)Nc2cccc(C(=O)N3CCC(C)CC3)c2)c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-15-9-11-26(12-10-15)21(28)17-6-4-8-19(14-17)24-23(31)25-20(27)16-5-3-7-18(13-16)22(29)30-2/h3-8,13-15H,9-12H2,1-2H3,(H2,24,25,27,31) |
| InChIKey | ZZLRXXAGLJDQCS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|