C22H24IN3O3S — CID 43886905
3-iodo-4-methoxy-N-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]benzamide (PubChem CID 43886905) has the molecular formula C22H24IN3O3S and a molecular weight of 537.42 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-iodo-4-methoxy-N-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43886905 |
| Molecular Formula | C22H24IN3O3S |
| Molecular Weight | 537.42 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | 3-iodo-4-methoxy-N-[[3-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)N3CCC(C)CC3)c2)cc1I |
| InChI | InChI=1S/C22H24IN3O3S/c1-14-8-10-26(11-9-14)21(28)16-4-3-5-17(12-16)24-22(30)25-20(27)15-6-7-19(29-2)18(23)13-15/h3-7,12-14H,8-11H2,1-2H3,(H2,24,25,27,30) |
| InChIKey | HDCBDLIDEYIGRJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|