About (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one
(3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one (PubChem CID 28641247) has the molecular formula C21H33N3O2
and a molecular weight of 359.51 g/mol. Its IUPAC name is (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one.
Molecular Properties
| Compound Name | (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one |
| PubChem CID | 28641247 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one |
| SMILES | CC(C)(C)CN1CCC[C@@](O)(CN2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C21H33N3O2/c1-20(2,3)16-24-11-7-10-21(26,19(24)25)17-22-12-14-23(15-13-22)18-8-5-4-6-9-18/h4-6,8-9,26H,7,10-17H2,1-3H3/t21-/m1/s1 |
| InChIKey | YVWVXLQTJDFDGJ-OAQYLSRUSA-N |
| XLogP | 2.21 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one?
The IUPAC name of (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one (CID 28641247) is (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one.
What is the SMILES notation for (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one?
The canonical SMILES for (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one is CC(C)(C)CN1CCC[C@@](O)(CN2CCN(c3ccccc3)CC2)C1=O.
What is the InChIKey of (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one?
The InChIKey is YVWVXLQTJDFDGJ-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H33N3O2/c1-20(2,3)16-24-11-7-10-21(26,19(24)25)17-22-12-14-23(15-13-22)18-8-5-4-6-9-18/h4-6,8-9,26H,7,10-17H2,1-3H3/t21-/m1/s1.
What are the key properties of (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one?
(3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one has a molecular weight of 359.51 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,2-dimethylpropyl)-3-hydroxy-3-[(4-phenylpiperazin-1-yl)methyl]piperidin-2-one is sourced from PubChem (CID 28641247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).