2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid

C15H10Cl3NO3 — CID 28666359

IUPAC2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid
SMILESO=C(Cc1ccc(Cl)cc1)Nc1cc(C(=O)O)c(Cl)cc1Cl
InChIInChI=1S/C15H10Cl3NO3/c16-9-3-1-8(2-4-9)5-14(20)19-13-6-10(15(21)22)11(17)7-12(13)18/h1-4,6-7H,5H2,(H,19,20)(H,21,22)
InChIKeyMQILOMIDQRPFCB-UHFFFAOYSA-N
MW358.61 g/mol
LogP4.53
Rot. Bonds4

About 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid

2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid (PubChem CID 28666359) has the molecular formula C15H10Cl3NO3 and a molecular weight of 358.61 g/mol. Its IUPAC name is 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid.

Molecular Properties

Compound Name2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid
PubChem CID28666359
Molecular FormulaC15H10Cl3NO3
Molecular Weight358.61 g/mol
Exact Mass356.97
IUPAC Name2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid
SMILESO=C(Cc1ccc(Cl)cc1)Nc1cc(C(=O)O)c(Cl)cc1Cl
InChIInChI=1S/C15H10Cl3NO3/c16-9-3-1-8(2-4-9)5-14(20)19-13-6-10(15(21)22)11(17)7-12(13)18/h1-4,6-7H,5H2,(H,19,20)(H,21,22)
InChIKeyMQILOMIDQRPFCB-UHFFFAOYSA-N
XLogP4.53
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.61
LogP ≤ 54.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid?
The IUPAC name of 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid (CID 28666359) is 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid.
What is the SMILES notation for 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid?
The canonical SMILES for 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid is O=C(Cc1ccc(Cl)cc1)Nc1cc(C(=O)O)c(Cl)cc1Cl.
What is the InChIKey of 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid?
The InChIKey is MQILOMIDQRPFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl3NO3/c16-9-3-1-8(2-4-9)5-14(20)19-13-6-10(15(21)22)11(17)7-12(13)18/h1-4,6-7H,5H2,(H,19,20)(H,21,22).
What are the key properties of 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid?
2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid has a molecular weight of 358.61 g/mol, XLogP of 4.53, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-[[2-(4-chlorophenyl)acetyl]amino]benzoic acid is sourced from PubChem (CID 28666359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).