C19H21N5O — CID 28667761
[(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(methylamino)-3-pyridinyl]methanone (PubChem CID 28667761) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 28667761 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[2-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1ncccc1C(=O)N1CCC[C@@H](c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C19H21N5O/c1-20-18-14(7-4-10-21-18)19(25)24-11-5-6-13(12-24)17-22-15-8-2-3-9-16(15)23-17/h2-4,7-10,13H,5-6,11-12H2,1H3,(H,20,21)(H,22,23)/t13-/m1/s1 |
| InChIKey | MFBUPVVFHBWRJQ-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |