C22H22N4O — CID 95861103
[(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-methylindol-4-yl)methanone (PubChem CID 95861103) has the molecular formula C22H22N4O and a molecular weight of 358.44 g/mol. Its IUPAC name is [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-methylindol-4-yl)methanone.
| Compound Name | [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-methylindol-4-yl)methanone |
|---|---|
| PubChem CID | 95861103 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(3R)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-(1-methylindol-4-yl)methanone |
| SMILES | Cn1ccc2c(C(=O)N3CCC[C@@H](c4nc5ccccc5[nH]4)C3)cccc21 |
| InChI | InChI=1S/C22H22N4O/c1-25-13-11-16-17(7-4-10-20(16)25)22(27)26-12-5-6-15(14-26)21-23-18-8-2-3-9-19(18)24-21/h2-4,7-11,13,15H,5-6,12,14H2,1H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | JJLMCFBBFZCTLY-OAHLLOKOSA-N |
| XLogP | 4.07 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |