C15H10Cl3NO4 — CID 28668233
3-chloro-5-[(3,4-dichlorobenzoyl)amino]-4-methoxybenzoic acid (PubChem CID 28668233) has the molecular formula C15H10Cl3NO4 and a molecular weight of 374.61 g/mol. Its IUPAC name is 3-chloro-5-[(3,4-dichlorobenzoyl)amino]-4-methoxybenzoic acid.
| Compound Name | 3-chloro-5-[(3,4-dichlorobenzoyl)amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 28668233 |
| Molecular Formula | C15H10Cl3NO4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 3-chloro-5-[(3,4-dichlorobenzoyl)amino]-4-methoxybenzoic acid |
| SMILES | COc1c(Cl)cc(C(=O)O)cc1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl3NO4/c1-23-13-11(18)5-8(15(21)22)6-12(13)19-14(20)7-2-3-9(16)10(17)4-7/h2-6H,1H3,(H,19,20)(H,21,22) |
| InChIKey | VFMAVZAKWKKWGM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |