C24H24BrN5O2 — CID 2867862
4-bromo-2-methoxy-6-[[methyl-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]amino]methyl]phenol (PubChem CID 2867862) has the molecular formula C24H24BrN5O2 and a molecular weight of 494.39 g/mol. Its IUPAC name is 4-bromo-2-methoxy-6-[[methyl-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]amino]methyl]phenol.
| Compound Name | 4-bromo-2-methoxy-6-[[methyl-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 2867862 |
| Molecular Formula | C24H24BrN5O2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 4-bromo-2-methoxy-6-[[methyl-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]amino]methyl]phenol |
| SMILES | COc1cc(Br)cc(CN(C)C(c2ccccc2)c2nnnn2-c2ccccc2C)c1O |
| InChI | InChI=1S/C24H24BrN5O2/c1-16-9-7-8-12-20(16)30-24(26-27-28-30)22(17-10-5-4-6-11-17)29(2)15-18-13-19(25)14-21(32-3)23(18)31/h4-14,22,31H,15H2,1-3H3 |
| InChIKey | XNTGEAGDPOCNMQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|