C20H19N7O — CID 46999614
N-methyl-N-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]-1H-pyrazole-5-carboxamide (PubChem CID 46999614) has the molecular formula C20H19N7O and a molecular weight of 373.42 g/mol. Its IUPAC name is N-methyl-N-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-methyl-N-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46999614 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-methyl-N-[[1-(2-methylphenyl)tetrazol-5-yl]-phenylmethyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccccc1-n1nnnc1C(c1ccccc1)N(C)C(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C20H19N7O/c1-14-8-6-7-11-17(14)27-19(23-24-25-27)18(15-9-4-3-5-10-15)26(2)20(28)16-12-13-21-22-16/h3-13,18H,1-2H3,(H,21,22) |
| InChIKey | QHKFZEGWDKRCNS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |