C18H18N2O5S — CID 28688527
4-[[(3,5-dimethoxybenzoyl)carbamothioylamino]methyl]benzoic acid (PubChem CID 28688527) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-[[(3,5-dimethoxybenzoyl)carbamothioylamino]methyl]benzoic acid.
| Compound Name | 4-[[(3,5-dimethoxybenzoyl)carbamothioylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 28688527 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-[[(3,5-dimethoxybenzoyl)carbamothioylamino]methyl]benzoic acid |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)NCc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C18H18N2O5S/c1-24-14-7-13(8-15(9-14)25-2)16(21)20-18(26)19-10-11-3-5-12(6-4-11)17(22)23/h3-9H,10H2,1-2H3,(H,22,23)(H2,19,20,21,26) |
| InChIKey | AVVGFCZMJNCOMB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|