C19H17NO7 — CID 2976254
4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid (PubChem CID 2976254) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 2976254 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(=O)NCc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C19H17NO7/c1-11(21)26-16-7-15(8-17(9-16)27-12(2)22)18(23)20-10-13-3-5-14(6-4-13)19(24)25/h3-9H,10H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | YIENLEKKPPVOLJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|