4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid

C19H17NO7 — CID 2976254

IUPAC4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid
SMILESCC(=O)Oc1cc(OC(C)=O)cc(C(=O)NCc2ccc(C(=O)O)cc2)c1
InChIInChI=1S/C19H17NO7/c1-11(21)26-16-7-15(8-17(9-16)27-12(2)22)18(23)20-10-13-3-5-14(6-4-13)19(24)25/h3-9H,10H2,1-2H3,(H,20,23)(H,24,25)
InChIKeyYIENLEKKPPVOLJ-UHFFFAOYSA-N
MW371.35 g/mol
LogP2.17
Rot. Bonds6

About 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid

4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid (PubChem CID 2976254) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid.

Molecular Properties

Compound Name4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid
PubChem CID2976254
Molecular FormulaC19H17NO7
Molecular Weight371.35 g/mol
Exact Mass371.10
IUPAC Name4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid
SMILESCC(=O)Oc1cc(OC(C)=O)cc(C(=O)NCc2ccc(C(=O)O)cc2)c1
InChIInChI=1S/C19H17NO7/c1-11(21)26-16-7-15(8-17(9-16)27-12(2)22)18(23)20-10-13-3-5-14(6-4-13)19(24)25/h3-9H,10H2,1-2H3,(H,20,23)(H,24,25)
InChIKeyYIENLEKKPPVOLJ-UHFFFAOYSA-N
XLogP2.17
TPSA119.00 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500371.35
LogP ≤ 52.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid?
The IUPAC name of 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid (CID 2976254) is 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid.
What is the SMILES notation for 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid?
The canonical SMILES for 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid is CC(=O)Oc1cc(OC(C)=O)cc(C(=O)NCc2ccc(C(=O)O)cc2)c1.
What is the InChIKey of 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid?
The InChIKey is YIENLEKKPPVOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO7/c1-11(21)26-16-7-15(8-17(9-16)27-12(2)22)18(23)20-10-13-3-5-14(6-4-13)19(24)25/h3-9H,10H2,1-2H3,(H,20,23)(H,24,25).
What are the key properties of 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid?
4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid has a molecular weight of 371.35 g/mol, XLogP of 2.17, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3,5-diacetyloxybenzoyl)amino]methyl]benzoic acid is sourced from PubChem (CID 2976254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).