C17H15NO7 — CID 175384350
4-[[(3-acetyloxy-2,5-dihydroxybenzoyl)amino]methyl]benzoic acid (PubChem CID 175384350) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is 4-[[(3-acetyloxy-2,5-dihydroxybenzoyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3-acetyloxy-2,5-dihydroxybenzoyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 175384350 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-[[(3-acetyloxy-2,5-dihydroxybenzoyl)amino]methyl]benzoic acid |
| SMILES | CC(=O)Oc1cc(O)cc(C(=O)NCc2ccc(C(=O)O)cc2)c1O |
| InChI | InChI=1S/C17H15NO7/c1-9(19)25-14-7-12(20)6-13(15(14)21)16(22)18-8-10-2-4-11(5-3-10)17(23)24/h2-7,20-21H,8H2,1H3,(H,18,22)(H,23,24) |
| InChIKey | BZLOFUWRSDQMED-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|