3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid

C7H8N2O4 — CID 28690740

IUPAC3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid
SMILESCCn1c(=O)[nH]cc(C(=O)O)c1=O
InChIInChI=1S/C7H8N2O4/c1-2-9-5(10)4(6(11)12)3-8-7(9)13/h3H,2H2,1H3,(H,8,13)(H,11,12)
InChIKeyZRRBELQVSBPWLH-UHFFFAOYSA-N
MW184.15 g/mol
LogP-0.75
Rot. Bonds2

About 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid

3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 28690740) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid
PubChem CID28690740
Molecular FormulaC7H8N2O4
Molecular Weight184.15 g/mol
Exact Mass184.05
IUPAC Name3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid
SMILESCCn1c(=O)[nH]cc(C(=O)O)c1=O
InChIInChI=1S/C7H8N2O4/c1-2-9-5(10)4(6(11)12)3-8-7(9)13/h3H,2H2,1H3,(H,8,13)(H,11,12)
InChIKeyZRRBELQVSBPWLH-UHFFFAOYSA-N
XLogP-0.75
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 5-0.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid (CID 28690740) is 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid is CCn1c(=O)[nH]cc(C(=O)O)c1=O.
What is the InChIKey of 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
The InChIKey is ZRRBELQVSBPWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-2-9-5(10)4(6(11)12)3-8-7(9)13/h3H,2H2,1H3,(H,8,13)(H,11,12).
What are the key properties of 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid?
3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid has a molecular weight of 184.15 g/mol, XLogP of -0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4-dioxo-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 28690740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).