C20H20N2O5 — CID 28691751
2-[2-(1,3-benzoxazol-2-yl)-4-(3-methylbutanoylamino)phenoxy]acetic acid (PubChem CID 28691751) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[2-(1,3-benzoxazol-2-yl)-4-(3-methylbutanoylamino)phenoxy]acetic acid.
| Compound Name | 2-[2-(1,3-benzoxazol-2-yl)-4-(3-methylbutanoylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 28691751 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[2-(1,3-benzoxazol-2-yl)-4-(3-methylbutanoylamino)phenoxy]acetic acid |
| SMILES | CC(C)CC(=O)Nc1ccc(OCC(=O)O)c(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-12(2)9-18(23)21-13-7-8-16(26-11-19(24)25)14(10-13)20-22-15-5-3-4-6-17(15)27-20/h3-8,10,12H,9,11H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | PVJZBEQPLCZOMU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |