C29H37N3O6 — CID 28692087
cis-(1S,2R)-2-[[6-[(Z)-N-[[2-(1-adamantyl)acetyl]amino]-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 28692087) has the molecular formula C29H37N3O6 and a molecular weight of 523.63 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[6-[(Z)-N-[[2-(1-adamantyl)acetyl]amino]-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[[6-[(Z)-N-[[2-(1-adamantyl)acetyl]amino]-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 28692087 |
| Molecular Formula | C29H37N3O6 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | cis-(1S,2R)-2-[[6-[(Z)-N-[[2-(1-adamantyl)acetyl]amino]-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | C/C(=N/NC(=O)CC12CC3CC(CC(C3)C1)C2)c1cc2c(cc1NC(=O)[C@@H]1CCCC[C@@H]1C(=O)O)OCO2 |
| InChI | InChI=1S/C29H37N3O6/c1-16(31-32-26(33)14-29-11-17-6-18(12-29)8-19(7-17)13-29)22-9-24-25(38-15-37-24)10-23(22)30-27(34)20-4-2-3-5-21(20)28(35)36/h9-10,17-21H,2-8,11-15H2,1H3,(H,30,34)(H,32,33)(H,35,36)/b31-16-/t17?,18?,19?,20-,21+,29?/m1/s1 |
| InChIKey | RPPXYKTVBZYCDY-BOVJRXJZSA-N |
| XLogP | 4.69 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|