C22H21N3O7 — CID 28693218
(1R,6R)-6-[[6-[(Z)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 28693218) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is (1R,6R)-6-[[6-[(Z)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6R)-6-[[6-[(Z)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 28693218 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (1R,6R)-6-[[6-[(Z)-N-(furan-2-carbonylamino)-C-methylcarbonimidoyl]-1,3-benzodioxol-5-yl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | C/C(=N/NC(=O)c1ccco1)c1cc2c(cc1NC(=O)[C@@H]1CC=CC[C@H]1C(=O)O)OCO2 |
| InChI | InChI=1S/C22H21N3O7/c1-12(24-25-21(27)17-7-4-8-30-17)15-9-18-19(32-11-31-18)10-16(15)23-20(26)13-5-2-3-6-14(13)22(28)29/h2-4,7-10,13-14H,5-6,11H2,1H3,(H,23,26)(H,25,27)(H,28,29)/b24-12-/t13-,14-/m1/s1 |
| InChIKey | MJYYRKOJVJQPCY-GYJPVHJYSA-N |
| XLogP | 2.77 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|