C18H17N3O6S — CID 19631224
4-[[6-[(E)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]amino]-4-oxobutanoic acid (PubChem CID 19631224) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is 4-[[6-[(E)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-[(E)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19631224 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 4-[[6-[(E)-C-methyl-N-(thiophene-2-carbonylamino)carbonimidoyl]-1,3-benzodioxol-5-yl]amino]-4-oxobutanoic acid |
| SMILES | C/C(=N\NC(=O)c1cccs1)c1cc2c(cc1NC(=O)CCC(=O)O)OCO2 |
| InChI | InChI=1S/C18H17N3O6S/c1-10(20-21-18(25)15-3-2-6-28-15)11-7-13-14(27-9-26-13)8-12(11)19-16(22)4-5-17(23)24/h2-3,6-8H,4-5,9H2,1H3,(H,19,22)(H,21,25)(H,23,24)/b20-10+ |
| InChIKey | XBZKCWCQLNRFKG-KEBDBYFISA-N |
| XLogP | 2.43 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|