C16H13BrN4O4S — CID 28695373
ethyl 4-(2-bromo-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28695373) has the molecular formula C16H13BrN4O4S and a molecular weight of 437.28 g/mol. Its IUPAC name is ethyl 4-(2-bromo-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-(2-bromo-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28695373 |
| Molecular Formula | C16H13BrN4O4S |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | ethyl 4-(2-bromo-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2ncnc(Nc3cc([N+](=O)[O-])ccc3Br)c2c1C |
| InChI | InChI=1S/C16H13BrN4O4S/c1-3-25-16(22)13-8(2)12-14(18-7-19-15(12)26-13)20-11-6-9(21(23)24)4-5-10(11)17/h4-7H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | IGOWIKBSXTZZEL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|