C14H10N4O5S — CID 28855823
4-(2-hydroxy-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 28855823) has the molecular formula C14H10N4O5S and a molecular weight of 346.32 g/mol. Its IUPAC name is 4-(2-hydroxy-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 4-(2-hydroxy-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 28855823 |
| Molecular Formula | C14H10N4O5S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-(2-hydroxy-5-nitroanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2ncnc(Nc3cc([N+](=O)[O-])ccc3O)c12 |
| InChI | InChI=1S/C14H10N4O5S/c1-6-10-12(15-5-16-13(10)24-11(6)14(20)21)17-8-4-7(18(22)23)2-3-9(8)19/h2-5,19H,1H3,(H,20,21)(H,15,16,17) |
| InChIKey | HCTZTDYPBJJOKC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|