C15H12N4O5S — CID 28856180
4-(2-hydroxy-5-nitroanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 28856180) has the molecular formula C15H12N4O5S and a molecular weight of 360.35 g/mol. Its IUPAC name is 4-(2-hydroxy-5-nitroanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 4-(2-hydroxy-5-nitroanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 28856180 |
| Molecular Formula | C15H12N4O5S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-(2-hydroxy-5-nitroanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | Cc1nc(Nc2cc([N+](=O)[O-])ccc2O)c2c(C)c(C(=O)O)sc2n1 |
| InChI | InChI=1S/C15H12N4O5S/c1-6-11-13(16-7(2)17-14(11)25-12(6)15(21)22)18-9-5-8(19(23)24)3-4-10(9)20/h3-5,20H,1-2H3,(H,21,22)(H,16,17,18) |
| InChIKey | SLRWGSSXJZHIFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|