C16H15N3O3S — CID 28856054
4-(2-hydroxy-5-methylanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 28856054) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-(2-hydroxy-5-methylanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 4-(2-hydroxy-5-methylanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 28856054 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 4-(2-hydroxy-5-methylanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | Cc1ccc(O)c(Nc2nc(C)nc3sc(C(=O)O)c(C)c23)c1 |
| InChI | InChI=1S/C16H15N3O3S/c1-7-4-5-11(20)10(6-7)19-14-12-8(2)13(16(21)22)23-15(12)18-9(3)17-14/h4-6,20H,1-3H3,(H,21,22)(H,17,18,19) |
| InChIKey | DAJMNQFTSLHBPN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|