C23H24N2O3S — CID 28696025
4-[4-(3-methylphenoxy)butyl]-6-(2-methyl-1,3-thiazol-4-yl)-1,4-benzoxazin-3-one (PubChem CID 28696025) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is 4-[4-(3-methylphenoxy)butyl]-6-(2-methyl-1,3-thiazol-4-yl)-1,4-benzoxazin-3-one.
| Compound Name | 4-[4-(3-methylphenoxy)butyl]-6-(2-methyl-1,3-thiazol-4-yl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28696025 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-[4-(3-methylphenoxy)butyl]-6-(2-methyl-1,3-thiazol-4-yl)-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(OCCCCN2C(=O)COc3ccc(-c4csc(C)n4)cc32)c1 |
| InChI | InChI=1S/C23H24N2O3S/c1-16-6-5-7-19(12-16)27-11-4-3-10-25-21-13-18(20-15-29-17(2)24-20)8-9-22(21)28-14-23(25)26/h5-9,12-13,15H,3-4,10-11,14H2,1-2H3 |
| InChIKey | LAAOKCNYDCYQKL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|