C26H31NO8 — CID 28701079
3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 28701079) has the molecular formula C26H31NO8 and a molecular weight of 485.53 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 28701079 |
| Molecular Formula | C26H31NO8 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(4-acetyloxy-3-ethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@@H](C)C2)[C@@H]1c1ccc(OC(C)=O)c(OCC)c1 |
| InChI | InChI=1S/C26H31NO8/c1-7-33-19-12-16(9-10-18(19)35-15(5)28)22-21(26(31)34-8-2)14(4)27-17-11-13(3)20(25(30)32-6)24(29)23(17)22/h9-10,12-13,20,22,27H,7-8,11H2,1-6H3/t13-,20+,22+/m0/s1 |
| InChIKey | CJRAROXHSWAHEL-VYALMSHHSA-N |
| XLogP | 3.19 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|