C24H28BrNO7 — CID 28700806
3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 28700806) has the molecular formula C24H28BrNO7 and a molecular weight of 522.39 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 28700806 |
| Molecular Formula | C24H28BrNO7 |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 3-O-ethyl 6-O-methyl (4S,6R,7S)-4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@@H](C)C2)[C@@H]1c1cc(Br)c(O)c(OCC)c1 |
| InChI | InChI=1S/C24H28BrNO7/c1-6-32-16-10-13(9-14(25)21(16)27)19-18(24(30)33-7-2)12(4)26-15-8-11(3)17(23(29)31-5)22(28)20(15)19/h9-11,17,19,26-27H,6-8H2,1-5H3/t11-,17+,19+/m0/s1 |
| InChIKey | PJNFQLOZNNQBOO-OWOPXTPDSA-N |
| XLogP | 3.73 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|