C23H26BrNO7 — CID 6559496
3-O-ethyl 6-O-methyl (4R,6S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 6559496) has the molecular formula C23H26BrNO7 and a molecular weight of 508.37 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl (4R,6S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl (4R,6S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 6559496 |
| Molecular Formula | C23H26BrNO7 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 3-O-ethyl 6-O-methyl (4R,6S,7S)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OC)[C@@H](C)C2)[C@H]1c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C23H26BrNO7/c1-6-32-23(29)17-11(3)25-14-7-10(2)16(22(28)31-5)21(27)19(14)18(17)12-8-13(24)20(26)15(9-12)30-4/h8-10,16,18,25-26H,6-7H2,1-5H3/t10-,16-,18-/m0/s1 |
| InChIKey | YBMWRHSFQAMSQZ-BMIZZYGASA-N |
| XLogP | 3.34 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|