C25H30BrNO7 — CID 94232245
3-O-ethyl 6-O-methyl (4R,6S,7R)-4-(3-bromo-4-ethoxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 94232245) has the molecular formula C25H30BrNO7 and a molecular weight of 536.42 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl (4R,6S,7R)-4-(3-bromo-4-ethoxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl (4R,6S,7R)-4-(3-bromo-4-ethoxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 94232245 |
| Molecular Formula | C25H30BrNO7 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 3-O-ethyl 6-O-methyl (4R,6S,7R)-4-(3-bromo-4-ethoxy-5-methoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@@H](C(=O)OC)[C@H](C)C2)[C@H]1c1cc(Br)c(OCC)c(OC)c1 |
| InChI | InChI=1S/C25H30BrNO7/c1-7-33-23-15(26)10-14(11-17(23)31-5)20-19(25(30)34-8-2)13(4)27-16-9-12(3)18(24(29)32-6)22(28)21(16)20/h10-12,18,20,27H,7-9H2,1-6H3/t12-,18+,20+/m1/s1 |
| InChIKey | OPFDPTMHNSIUPF-OACQNMCBSA-N |
| XLogP | 4.03 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|