C25H31NO8 — CID 4671149
6-O-methyl 3-O-propan-2-yl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 4671149) has the molecular formula C25H31NO8 and a molecular weight of 473.52 g/mol. Its IUPAC name is 6-O-methyl 3-O-propan-2-yl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 6-O-methyl 3-O-propan-2-yl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 4671149 |
| Molecular Formula | C25H31NO8 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 6-O-methyl 3-O-propan-2-yl 4-(4-hydroxy-3,5-dimethoxyphenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C2=C(CC1C)NC(C)=C(C(=O)OC(C)C)C2c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C25H31NO8/c1-11(2)34-25(30)19-13(4)26-15-8-12(3)18(24(29)33-7)23(28)21(15)20(19)14-9-16(31-5)22(27)17(10-14)32-6/h9-12,18,20,26-27H,8H2,1-7H3 |
| InChIKey | RARLKUHNCJHCGW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|