C19H20BrNO6 — CID 41123621
methyl (4R,6R,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-methyl-2,5-dioxo-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate (PubChem CID 41123621) has the molecular formula C19H20BrNO6 and a molecular weight of 438.27 g/mol. Its IUPAC name is methyl (4R,6R,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-methyl-2,5-dioxo-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate.
| Compound Name | methyl (4R,6R,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-methyl-2,5-dioxo-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 41123621 |
| Molecular Formula | C19H20BrNO6 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | methyl (4R,6R,7R)-4-(3-bromo-4-hydroxy-5-methoxyphenyl)-7-methyl-2,5-dioxo-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C2=C(C[C@H]1C)NC(=O)C[C@@H]2c1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C19H20BrNO6/c1-8-4-12-16(18(24)15(8)19(25)27-3)10(7-14(22)21-12)9-5-11(20)17(23)13(6-9)26-2/h5-6,8,10,15,23H,4,7H2,1-3H3,(H,21,22)/t8-,10-,15-/m1/s1 |
| InChIKey | NXSISCUBSDSTEL-FFTROKDMSA-N |
| XLogP | 2.42 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|