C18H16N2O2S — CID 2870276
8-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)quinoline (PubChem CID 2870276) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 8-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)quinoline.
| Compound Name | 8-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)quinoline |
|---|---|
| PubChem CID | 2870276 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 8-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)quinoline |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H16N2O2S/c21-23(22,17-11-3-7-15-8-4-12-19-18(15)17)20-13-5-9-14-6-1-2-10-16(14)20/h1-4,6-8,10-12H,5,9,13H2 |
| InChIKey | SVHOOIZUTPIDOF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |