C15H10N2O2S — CID 659101
5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide (PubChem CID 659101) has the molecular formula C15H10N2O2S and a molecular weight of 282.32 g/mol. Its IUPAC name is 5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide.
| Compound Name | 5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide |
|---|---|
| PubChem CID | 659101 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide |
| SMILES | O=S1(=O)Nc2c(ccc3cccnc23)-c2ccccc21 |
| InChI | InChI=1S/C15H10N2O2S/c18-20(19)13-6-2-1-5-11(13)12-8-7-10-4-3-9-16-14(10)15(12)17-20/h1-9,17H |
| InChIKey | CYSOFAOLQAYKGU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |