C26H23N3S2 — CID 2870311
[(3-benzyl-2,6-diphenyl-2H-thiopyran-5-yl)methylideneamino]thiourea (PubChem CID 2870311) has the molecular formula C26H23N3S2 and a molecular weight of 441.63 g/mol. Its IUPAC name is [(3-benzyl-2,6-diphenyl-2H-thiopyran-5-yl)methylideneamino]thiourea.
| Compound Name | [(3-benzyl-2,6-diphenyl-2H-thiopyran-5-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2870311 |
| Molecular Formula | C26H23N3S2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [(3-benzyl-2,6-diphenyl-2H-thiopyran-5-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=CC1=C(c2ccccc2)SC(c2ccccc2)C(Cc2ccccc2)=C1 |
| InChI | InChI=1S/C26H23N3S2/c27-26(30)29-28-18-23-17-22(16-19-10-4-1-5-11-19)24(20-12-6-2-7-13-20)31-25(23)21-14-8-3-9-15-21/h1-15,17-18,24H,16H2,(H3,27,29,30) |
| InChIKey | SHIMQAFXPKRXRL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|