C19H19N3O — CID 28707231
1-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1H-indol-3-yl)ethanone (PubChem CID 28707231) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1H-indol-3-yl)ethanone.
| Compound Name | 1-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 28707231 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(1H-indol-3-yl)ethanone |
| SMILES | Nc1ccc2c(c1)CN(C(=O)Cc1c[nH]c3ccccc13)CC2 |
| InChI | InChI=1S/C19H19N3O/c20-16-6-5-13-7-8-22(12-15(13)9-16)19(23)10-14-11-21-18-4-2-1-3-17(14)18/h1-6,9,11,21H,7-8,10,12,20H2 |
| InChIKey | WEHGYOKRSWYBPN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|