C25H27N3O4 — CID 86656589
2-[2-(1H-indol-3-yl)acetyl]-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 86656589) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[2-(1H-indol-3-yl)acetyl]-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-[2-(1H-indol-3-yl)acetyl]-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 86656589 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[2-(1H-indol-3-yl)acetyl]-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | O=C(NOC1CCCCO1)c1ccc2c(c1)CCN(C(=O)Cc1c[nH]c3ccccc13)C2 |
| InChI | InChI=1S/C25H27N3O4/c29-23(14-20-15-26-22-6-2-1-5-21(20)22)28-11-10-17-13-18(8-9-19(17)16-28)25(30)27-32-24-7-3-4-12-31-24/h1-2,5-6,8-9,13,15,24,26H,3-4,7,10-12,14,16H2,(H,27,30) |
| InChIKey | RAMTXSBKFIZJKG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|