C23H27N3O4 — CID 87188952
2-N-benzyl-6-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-2,6-dicarboxamide (PubChem CID 87188952) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-N-benzyl-6-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-2,6-dicarboxamide.
| Compound Name | 2-N-benzyl-6-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87188952 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-N-benzyl-6-N-(oxan-2-yloxy)-3,4-dihydro-1H-isoquinoline-2,6-dicarboxamide |
| SMILES | O=C(NOC1CCCCO1)c1ccc2c(c1)CCN(C(=O)NCc1ccccc1)C2 |
| InChI | InChI=1S/C23H27N3O4/c27-22(25-30-21-8-4-5-13-29-21)19-9-10-20-16-26(12-11-18(20)14-19)23(28)24-15-17-6-2-1-3-7-17/h1-3,6-7,9-10,14,21H,4-5,8,11-13,15-16H2,(H,24,28)(H,25,27) |
| InChIKey | ILDZTLKFUAWDGW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|