C8H21N3O2S — CID 28708159
N'-tert-butyl-N'-(dimethylsulfamoyl)ethane-1,2-diamine (PubChem CID 28708159) has the molecular formula C8H21N3O2S and a molecular weight of 223.34 g/mol. Its IUPAC name is N'-tert-butyl-N'-(dimethylsulfamoyl)ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N'-(dimethylsulfamoyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 28708159 |
| Molecular Formula | C8H21N3O2S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N'-tert-butyl-N'-(dimethylsulfamoyl)ethane-1,2-diamine |
| SMILES | CN(C)S(=O)(=O)N(CCN)C(C)(C)C |
| InChI | InChI=1S/C8H21N3O2S/c1-8(2,3)11(7-6-9)14(12,13)10(4)5/h6-7,9H2,1-5H3 |
| InChIKey | KKMWTYUNVBNLHE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |