C16H12ClFN2S — CID 28710053
5-(chloromethyl)-4-(4-fluoro-3-methylphenyl)-2-pyridin-4-yl-1,3-thiazole (PubChem CID 28710053) has the molecular formula C16H12ClFN2S and a molecular weight of 318.80 g/mol. Its IUPAC name is 5-(chloromethyl)-4-(4-fluoro-3-methylphenyl)-2-pyridin-4-yl-1,3-thiazole.
| Compound Name | 5-(chloromethyl)-4-(4-fluoro-3-methylphenyl)-2-pyridin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 28710053 |
| Molecular Formula | C16H12ClFN2S |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 5-(chloromethyl)-4-(4-fluoro-3-methylphenyl)-2-pyridin-4-yl-1,3-thiazole |
| SMILES | Cc1cc(-c2nc(-c3ccncc3)sc2CCl)ccc1F |
| InChI | InChI=1S/C16H12ClFN2S/c1-10-8-12(2-3-13(10)18)15-14(9-17)21-16(20-15)11-4-6-19-7-5-11/h2-8H,9H2,1H3 |
| InChIKey | CUYSNEZYUDTXBK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|