C12H13BrN2O2 — CID 28712167
N-[(5-bromofuran-2-yl)methyl]-1-(6-methoxy-3-pyridinyl)methanamine (PubChem CID 28712167) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-1-(6-methoxy-3-pyridinyl)methanamine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-1-(6-methoxy-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 28712167 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-1-(6-methoxy-3-pyridinyl)methanamine |
| SMILES | COc1ccc(CNCc2ccc(Br)o2)cn1 |
| InChI | InChI=1S/C12H13BrN2O2/c1-16-12-5-2-9(7-15-12)6-14-8-10-3-4-11(13)17-10/h2-5,7,14H,6,8H2,1H3 |
| InChIKey | JKALLDMZOZAVCZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |