C15H17N3S — CID 28712943
2-(2-methylbenzimidazol-1-yl)-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 28712943) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-(2-methylbenzimidazol-1-yl)-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | 2-(2-methylbenzimidazol-1-yl)-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 28712943 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-(2-methylbenzimidazol-1-yl)-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | Cc1nc2ccccc2n1CCNCc1cccs1 |
| InChI | InChI=1S/C15H17N3S/c1-12-17-14-6-2-3-7-15(14)18(12)9-8-16-11-13-5-4-10-19-13/h2-7,10,16H,8-9,11H2,1H3 |
| InChIKey | XZMOIEFUZDIUMN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|