C14H22N4 — CID 60697290
N',N'-dimethyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 60697290) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60697290 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N',N'-dimethyl-N-[2-(2-methylbenzimidazol-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | Cc1nc2ccccc2n1CCNCCN(C)C |
| InChI | InChI=1S/C14H22N4/c1-12-16-13-6-4-5-7-14(13)18(12)11-9-15-8-10-17(2)3/h4-7,15H,8-11H2,1-3H3 |
| InChIKey | JJTLXRRQSCAXTO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|