C16H18N2O — CID 28720339
N-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-N-methylaniline (PubChem CID 28720339) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-N-methylaniline.
| Compound Name | N-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-N-methylaniline |
|---|---|
| PubChem CID | 28720339 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-N-methylaniline |
| SMILES | CN(Cc1ccc2c(c1)NCCO2)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O/c1-18(14-5-3-2-4-6-14)12-13-7-8-16-15(11-13)17-9-10-19-16/h2-8,11,17H,9-10,12H2,1H3 |
| InChIKey | BFMPVZKSGCKTQH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |