About 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine
6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 58641530) has the molecular formula C14H13NO3S
and a molecular weight of 275.33 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 58641530 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C14H13NO3S/c16-19(17,11-4-2-1-3-5-11)12-6-7-14-13(10-12)15-8-9-18-14/h1-7,10,15H,8-9H2 |
| InChIKey | YFVISRDZPUNDGD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine (CID 58641530) is 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine is O=S(=O)(c1ccccc1)c1ccc2c(c1)NCCO2.
What is the InChIKey of 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is YFVISRDZPUNDGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3S/c16-19(17,11-4-2-1-3-5-11)12-6-7-14-13(10-12)15-8-9-18-14/h1-7,10,15H,8-9H2.
What are the key properties of 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine?
6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 275.33 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 58641530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).