C14H13NO3S — CID 58641530
6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 58641530) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 58641530 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 6-(benzenesulfonyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C14H13NO3S/c16-19(17,11-4-2-1-3-5-11)12-6-7-14-13(10-12)15-8-9-18-14/h1-7,10,15H,8-9H2 |
| InChIKey | YFVISRDZPUNDGD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |