C18H24N2O3 — CID 28731167
[(2S)-2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(2-methyl-1-benzofuran-7-yl)methanone (PubChem CID 28731167) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(2S)-2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(2-methyl-1-benzofuran-7-yl)methanone.
| Compound Name | [(2S)-2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(2-methyl-1-benzofuran-7-yl)methanone |
|---|---|
| PubChem CID | 28731167 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [(2S)-2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(2-methyl-1-benzofuran-7-yl)methanone |
| SMILES | Cc1cc2cccc(C(=O)N3CCO[C@@H](CCN(C)C)C3)c2o1 |
| InChI | InChI=1S/C18H24N2O3/c1-13-11-14-5-4-6-16(17(14)23-13)18(21)20-9-10-22-15(12-20)7-8-19(2)3/h4-6,11,15H,7-10,12H2,1-3H3/t15-/m0/s1 |
| InChIKey | KUODEWWAWQTGFK-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |