C17H22FN3O2 — CID 45173722
[2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(5-fluoro-1H-indol-2-yl)methanone (PubChem CID 45173722) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is [2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(5-fluoro-1H-indol-2-yl)methanone.
| Compound Name | [2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(5-fluoro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 45173722 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [2-[2-(dimethylamino)ethyl]morpholin-4-yl]-(5-fluoro-1H-indol-2-yl)methanone |
| SMILES | CN(C)CCC1CN(C(=O)c2cc3cc(F)ccc3[nH]2)CCO1 |
| InChI | InChI=1S/C17H22FN3O2/c1-20(2)6-5-14-11-21(7-8-23-14)17(22)16-10-12-9-13(18)3-4-15(12)19-16/h3-4,9-10,14,19H,5-8,11H2,1-2H3 |
| InChIKey | LSHSTGGGVXOBKB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |