C18H24FN3O2 — CID 56886344
[4-[(dimethylamino)methyl]-4-hydroxyazepan-1-yl]-(5-fluoro-1H-indol-2-yl)methanone (PubChem CID 56886344) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]-4-hydroxyazepan-1-yl]-(5-fluoro-1H-indol-2-yl)methanone.
| Compound Name | [4-[(dimethylamino)methyl]-4-hydroxyazepan-1-yl]-(5-fluoro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 56886344 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [4-[(dimethylamino)methyl]-4-hydroxyazepan-1-yl]-(5-fluoro-1H-indol-2-yl)methanone |
| SMILES | CN(C)CC1(O)CCCN(C(=O)c2cc3cc(F)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H24FN3O2/c1-21(2)12-18(24)6-3-8-22(9-7-18)17(23)16-11-13-10-14(19)4-5-15(13)20-16/h4-5,10-11,20,24H,3,6-9,12H2,1-2H3 |
| InChIKey | PAMDCDIIYHFVJZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |