C20H26F3N5O2 — CID 28731341
N-methyl-N-(4-morpholin-4-ylbutyl)-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide (PubChem CID 28731341) has the molecular formula C20H26F3N5O2 and a molecular weight of 425.46 g/mol. Its IUPAC name is N-methyl-N-(4-morpholin-4-ylbutyl)-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | N-methyl-N-(4-morpholin-4-ylbutyl)-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 28731341 |
| Molecular Formula | C20H26F3N5O2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-methyl-N-(4-morpholin-4-ylbutyl)-1-[[3-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide |
| SMILES | CN(CCCCN1CCOCC1)C(=O)c1cn(Cc2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C20H26F3N5O2/c1-26(7-2-3-8-27-9-11-30-12-10-27)19(29)18-15-28(25-24-18)14-16-5-4-6-17(13-16)20(21,22)23/h4-6,13,15H,2-3,7-12,14H2,1H3 |
| InChIKey | CACDZLORZWAYIN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|