C11H12ClF2NO — CID 28733613
5-chloro-N-(3,5-difluorophenyl)pentanamide (PubChem CID 28733613) has the molecular formula C11H12ClF2NO and a molecular weight of 247.67 g/mol. Its IUPAC name is 5-chloro-N-(3,5-difluorophenyl)pentanamide.
| Compound Name | 5-chloro-N-(3,5-difluorophenyl)pentanamide |
|---|---|
| PubChem CID | 28733613 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-chloro-N-(3,5-difluorophenyl)pentanamide |
| SMILES | O=C(CCCCCl)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H12ClF2NO/c12-4-2-1-3-11(16)15-10-6-8(13)5-9(14)7-10/h5-7H,1-4H2,(H,15,16) |
| InChIKey | GQUSVJMOPNCIJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|